Difference between revisions of "OROTIDINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3713 == * common-name: ** cytidine 2',3'-cyclic monophosphate * smiles: ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o * in...")
(Created page with "Category:metabolite == Metabolite Sugar-alcohols == * common-name: ** a sugar alcohol == Reaction(s) known to consume the compound == * ALDEHYDE-REDUCTASE-RXN * RXN-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3713 ==
+
== Metabolite Sugar-alcohols ==
 
* common-name:
 
* common-name:
** cytidine 2',3'-cyclic monophosphate
+
** a sugar alcohol
* smiles:
 
** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
 
* inchi-key:
 
** nmpzcczxcomsdq-xvfcmesisa-m
 
* molecular-weight:
 
** 304.176
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12059]]
+
* [[ALDEHYDE-REDUCTASE-RXN]]
 +
* [[RXN-9926]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALDEHYDE-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cytidine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=a sugar alcohol}}
{{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}}
 
{{#set: molecular-weight=304.176}}
 

Revision as of 11:18, 15 January 2021

Metabolite Sugar-alcohols

  • common-name:
    • a sugar alcohol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality