Difference between revisions of "OROTIDINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199] == * direction: ** reversible * common-name: ** guanosine phosphorylase * ec-n...")
(Created page with "Category:metabolite == Metabolite OROTIDINE-5-PHOSPHATE == * common-name: ** orotidine 5'-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)n...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199] ==
+
== Metabolite OROTIDINE-5-PHOSPHATE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** guanosine phosphorylase
+
** orotidine 5'-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.2.15 ec-2.4.2.15]
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
−
** [http://enzyme.expasy.org/EC/2.4.2.1 ec-2.4.2.1]
+
* inchi-key:
−
== Reaction formula ==
+
** kyobshfobaofbf-xvfcmesisa-k
−
* 1 [[GUANOSINE]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[GUANINE]][c] '''+''' 1 [[RIBOSE-1P]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 365.17
−
* Gene: [[SJ03195]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[OROPRIBTRANS-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[OROTPDECARB-RXN]]
−
== Pathway(s) ==
+
* [[ORPDC]]
−
* [[PWY-5532]], nucleoside and nucleotide degradation (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532]
+
* [[ORPRT]]
−
** '''4''' reactions found over '''10''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6608]], guanosine nucleotides degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608]
+
* [[OROPRIBTRANS-RXN]]
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[ORPRT]]
−
* [[PWY-6620]], guanine and guanosine salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6620 PWY-6620]
+
== Reaction(s) of unknown directionality ==
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
{{#set: common-name=orotidine 5'-phosphate}}
−
* [[PWY0-1296]], purine ribonucleosides degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1296 PWY0-1296]
+
{{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}}
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
{{#set: molecular-weight=365.17}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13236 13236]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02147 R02147]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=guanosine phosphorylase}}
 
−
{{#set: ec-number=ec-2.4.2.15|ec-2.4.2.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=4}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite OROTIDINE-5-PHOSPHATE

  • common-name:
    • orotidine 5'-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
  • inchi-key:
    • kyobshfobaofbf-xvfcmesisa-k
  • molecular-weight:
    • 365.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OROTIDINE-5-PHOSPHATE&oldid=138924"