Difference between revisions of "OXALACETIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10231 == * transcription-direction: ** negative * right-end-position: ** 18928 * left-end-position: ** 5049 * centisome-position: ** 1.280549 =...")
 
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=o)c([o-])=o * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * m...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10231 ==
+
== Metabolite OXALACETIC_ACID ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** oxaloacetate
−
* right-end-position:
+
* smiles:
−
** 18928
+
** c(c([o-])=o)c(=o)c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 5049
+
** khpxuqmniqbqev-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 1.280549   
+
** 130.057
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ASPAMINOTRANS-RXN]]
−
== Reaction(s) associated ==
+
* [[CITSYN-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[CSm]]
−
* [[ATPASE-RXN]]
+
* [[MALATE-DEH-RXN]]
−
** Category: [[annotation]]
+
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[OAAAKGtm]]
−
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[OAACITtm]]
−
** Category: [[orthology]]
+
* [[OXALODECARB-RXN]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[PCr]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[PEPCARBOXYKIN-RXN]]
−
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-13697]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-2464]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[ASPAMINOTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ATPCL]]
−
* [[RXN-11109]]
+
* [[MALATE-DEH-RXN]]
−
** Category: [[annotation]]
+
* [[OAAAKGtm]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[OAACITtm]]
−
* [[RXN-12195]]
+
* [[OXALOACETATE-TAUTOMERASE-RXN]]
−
** Category: [[annotation]]
+
* [[PCr]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PEPCARBOX-RXN]]
−
* [[RXN-12196]]
+
* [[PPC]]
−
** Category: [[annotation]]
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PYRUVATE-CARBOXYLASE-RXN]]
−
* [[RXN0-5462]]
+
* [[RXN-13697]]
−
** Category: [[annotation]]
+
* [[RXN-2464]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
</div>
+
{{#set: common-name=oxaloacetate}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
−
* [[PWY-6797]]
+
{{#set: molecular-weight=130.057}}
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6147]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7539]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=18928}}
 
−
{{#set: left-end-position=5049}}
 
−
{{#set: centisome-position=1.280549    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite OXALACETIC_ACID

  • common-name:
    • oxaloacetate
  • smiles:
    • c(c([o-])=o)c(=o)c([o-])=o
  • inchi-key:
    • khpxuqmniqbqev-uhfffaoysa-l
  • molecular-weight:
    • 130.057

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OXALACETIC_ACID&oldid=136895"