Difference between revisions of "OXALACETIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8607 == * common-name: ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)(c...")
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=o)c([o-])=o * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * m...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8607 ==
+
== Metabolite OXALACETIC_ACID ==
 
* common-name:
 
* common-name:
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** oxaloacetate
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)(c(co)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
+
** c(c([o-])=o)c(=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** sjpdnxkpbqhpmz-puxrvuthsa-n
+
** khpxuqmniqbqev-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 444.74
+
** 130.057
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-12]]
+
* [[ASPAMINOTRANS-RXN]]
 +
* [[CITSYN-RXN]]
 +
* [[CSm]]
 +
* [[MALATE-DEH-RXN]]
 +
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[OAACITtm]]
 +
* [[OXALODECARB-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-11]]
+
* [[ASPAMINOTRANS-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPCL]]
 +
* [[MALATE-DEH-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[OAACITtm]]
 +
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PPC]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: common-name=oxaloacetate}}
{{#set: inchi-key=inchikey=sjpdnxkpbqhpmz-puxrvuthsa-n}}
+
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
{{#set: molecular-weight=444.74}}
+
{{#set: molecular-weight=130.057}}

Latest revision as of 11:11, 18 March 2021