Difference between revisions of "OXALATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00677 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DIHYDRONEOPTERIN-MONO-P-...") |
(Created page with "Category:metabolite == Metabolite TDP == * common-name: ** dtdp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: ** ujlxyodchael...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite TDP == |
| − | == | + | * common-name: |
| − | + | ** dtdp | |
| − | + | * smiles: | |
| − | * | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ujlxyodchaelly-xlpzgreqsa-k |
| − | * [[ | + | * molecular-weight: |
| − | * | + | ** 399.167 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | == | + | * [[DTDPKIN-RXN]] |
| − | * [[ | + | * [[RXN-14213]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[DTMPKI-RXN]] |
| − | + | * [[THYMIDINE-TRIPHOSPHATASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=dtdp}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=ujlxyodchaelly-xlpzgreqsa-k}} |
| − | {{#set: | + | {{#set: molecular-weight=399.167}} |
| − | {{#set: | ||
Revision as of 20:32, 18 December 2020
Contents
Metabolite TDP
- common-name:
- dtdp
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2))
- inchi-key:
- ujlxyodchaelly-xlpzgreqsa-k
- molecular-weight:
- 399.167
