Difference between revisions of "OXALO-SUCCINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...") |
(Created page with "Category:metabolite == Metabolite OXALO-SUCCINATE == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o * inchi-key: ** ufscuaxltrfidc-uh...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OXALO-SUCCINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** oxalosuccinate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufscuaxltrfidc-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 187.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8642]] |
| − | * [[RXN- | + | * [[RXN-9951]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8642]] | ||
| + | * [[RXN-9951]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=oxalosuccinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=187.085}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite OXALO-SUCCINATE
- common-name:
- oxalosuccinate
- smiles:
- c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
- inchi-key:
- ufscuaxltrfidc-uhfffaoysa-k
- molecular-weight:
- 187.085
