Difference between revisions of "OXIDATIVEPENT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == * common-name: ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone * sm...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IS30-Insertion-Sequences IS30-Insertion-Sequences] == * common-name: ** an insertion sequence e...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IS30-Insertion-Sequences IS30-Insertion-Sequences] ==
 
* common-name:
 
* common-name:
** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+
** an insertion sequence element is30
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
 
* inchi-key:
 
** flybtlrocqbhmr-kfsstaeesa-n
 
* molecular-weight:
 
** 697.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5131]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14177]]
+
* [[RXN0-5131]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
+
{{#set: common-name=an insertion sequence element is30}}
{{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}}
 
{{#set: molecular-weight=697.095}}
 

Revision as of 09:22, 27 August 2019

Metabolite IS30-Insertion-Sequences

  • common-name:
    • an insertion sequence element is30

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality