Difference between revisions of "OXIDIZED-GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14594 == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** fersmfqb...") |
(Created page with "Category:metabolite == Metabolite 3-Methyl-Saturated-Fatty-Acids == * common-name: ** a 3-methyl-branched 2,3,4-saturated fatty acid == Reaction(s) known to consume the co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Methyl-Saturated-Fatty-Acids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-methyl-branched 2,3,4-saturated fatty acid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-469]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-methyl-branched 2,3,4-saturated fatty acid}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite 3-Methyl-Saturated-Fatty-Acids
- common-name:
- a 3-methyl-branched 2,3,4-saturated fatty acid
