Difference between revisions of "OXIDIZED-GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-Methyl-Saturated-Fatty-Acids == * common-name: ** a 3-methyl-branched 2,3,4-saturated fatty acid == Reaction(s) known to consume the co...")
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * common-name: ** glutathione disulfide * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-Methyl-Saturated-Fatty-Acids ==
+
== Metabolite OXIDIZED-GLUTATHIONE ==
 
* common-name:
 
* common-name:
** a 3-methyl-branched 2,3,4-saturated fatty acid
+
** glutathione disulfide
 +
* smiles:
 +
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 +
* inchi-key:
 +
** ypzrwbkmtbyptk-bjdjzhngsa-l
 +
* molecular-weight:
 +
** 610.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-469]]
+
* [[GDR]]
 +
* [[GDR_LPAREN_nadp_RPAREN_]]
 +
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GDRh]]
 +
* [[GDRm]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.11.1.12-RXN]]
 +
* [[1.8.4.9-RXN]]
 +
* [[1.8.5.1-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GTHP]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-methyl-branched 2,3,4-saturated fatty acid}}
+
{{#set: common-name=glutathione disulfide}}
 +
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
 +
{{#set: molecular-weight=610.61}}

Latest revision as of 11:15, 18 March 2021

Metabolite OXIDIZED-GLUTATHIONE

  • common-name:
    • glutathione disulfide
  • smiles:
    • c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • ypzrwbkmtbyptk-bjdjzhngsa-l
  • molecular-weight:
    • 610.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality