Difference between revisions of "OXIDIZED-GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13709 RXN-13709] == * direction: ** left-to-right * common-name: ** 4-methylsterol monooxygenas...")
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * common-name: ** glutathione disulfide * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13709 RXN-13709] ==
+
== Metabolite OXIDIZED-GLUTATHIONE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 4-methylsterol monooxygenase
+
** glutathione disulfide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.18.9 ec-1.14.18.9]
+
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[4-METHYL-824-CHOLESTADIENOL]][c] '''+''' 6 [[FERROCYTOCHROME-B5]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''+''' 5 [[PROTON]][c] '''=>''' 1 [[CPD-4702]][c] '''+''' 6 [[FERRICYTOCHROME-B5]][c] '''+''' 4 [[WATER]][c]
+
** ypzrwbkmtbyptk-bjdjzhngsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
== Pathway(s)  ==
+
** 610.61
−
== Reconstruction information  ==
+
== Reaction(s) known to consume the compound ==
−
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
* [[GDR]]
−
== External links  ==
+
* [[GDR_LPAREN_nadp_RPAREN_]]
−
{{#set: direction=left-to-right}}
+
* [[GDR_LPAREN_nadp_RPAREN_h]]
−
{{#set: common-name=4-methylsterol monooxygenase}}
+
* [[GDR_LPAREN_nadp_RPAREN_m]]
−
{{#set: ec-number=ec-1.14.18.9}}
+
* [[GDRh]]
−
{{#set: nb gene associated=0}}
+
* [[GDRm]]
−
{{#set: nb pathway associated=0}}
+
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
−
{{#set: reconstruction category=gap-filling}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: reconstruction tool=meneco}}
+
* [[1.11.1.12-RXN]]
−
{{#set: reconstruction comment=added for gapfilling}}
+
* [[1.8.4.9-RXN]]
−
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
+
* [[1.8.5.1-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GTHP]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=glutathione disulfide}}
 +
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
 +
{{#set: molecular-weight=610.61}}

Latest revision as of 11:15, 18 March 2021

Metabolite OXIDIZED-GLUTATHIONE

  • common-name:
    • glutathione disulfide
  • smiles:
    • c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • ypzrwbkmtbyptk-bjdjzhngsa-l
  • molecular-weight:
    • 610.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OXIDIZED-GLUTATHIONE&oldid=138697"