Difference between revisions of "OXIDIZED-GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14594 == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** fersmfqb...")
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * common-name: ** glutathione disulfide * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14594 ==
+
== Metabolite OXIDIZED-GLUTATHIONE ==
 
* common-name:
 
* common-name:
** linustatin
+
** glutathione disulfide
 
* smiles:
 
* smiles:
** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
+
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** fersmfqbwvbkqk-cxttvelosa-n
+
** ypzrwbkmtbyptk-bjdjzhngsa-l
 
* molecular-weight:
 
* molecular-weight:
** 409.389
+
** 610.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13602]]
+
* [[GDR]]
 +
* [[GDR_LPAREN_nadp_RPAREN_]]
 +
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GDRh]]
 +
* [[GDRm]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.11.1.12-RXN]]
 +
* [[1.8.4.9-RXN]]
 +
* [[1.8.5.1-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GTHP]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=linustatin}}
+
{{#set: common-name=glutathione disulfide}}
{{#set: inchi-key=inchikey=fersmfqbwvbkqk-cxttvelosa-n}}
+
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
{{#set: molecular-weight=409.389}}
+
{{#set: molecular-weight=610.61}}

Latest revision as of 11:15, 18 March 2021

Metabolite OXIDIZED-GLUTATHIONE

  • common-name:
    • glutathione disulfide
  • smiles:
    • c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • ypzrwbkmtbyptk-bjdjzhngsa-l
  • molecular-weight:
    • 610.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality