Difference between revisions of "OXYGEN-MOLECULE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * smiles: ** c1(c(o)c(co)oc1op(=o)([o-])[o-]) * inch...") |
(Created page with "Category:metabolite == Metabolite FRU == * common-name: ** d-fructose == Reaction(s) known to consume the compound == * SBTD_D2 == Reaction(s) known to produce the com...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite FRU == |
* common-name: | * common-name: | ||
− | ** | + | ** d-fructose |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[SBTD_D2]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-fructose}} |
− | |||
− |
Revision as of 08:28, 15 March 2021
Contents
Metabolite FRU
- common-name:
- d-fructose