Difference between revisions of "Octanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
(Created page with "Category:metabolite == Metabolite Octanoyl-ACPs == * common-name: ** an octanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-13037 * RXN-9527 * R...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Octanoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an octanoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13037]] |
| + | * [[RXN-9527]] | ||
| + | * [[RXN-9651]] | ||
| + | * [[RXN0-947]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9526]] | ||
| + | * [[RXN-9659]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an octanoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Octanoyl-ACPs
- common-name:
- an octanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an octanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
