Difference between revisions of "Octanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
(Created page with "Category:metabolite == Metabolite CPD-15699 == * common-name: ** aldehydo-l-arabinose * smiles: ** [ch](=o)c(o)c(o)c(o)co * inchi-key: ** pymyphuhkuwmla-vayjurfesa-n * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15699 == |
* common-name: | * common-name: | ||
− | ** | + | ** aldehydo-l-arabinose |
* smiles: | * smiles: | ||
− | ** | + | ** [ch](=o)c(o)c(o)c(o)co |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pymyphuhkuwmla-vayjurfesa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14102]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14102]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=aldehydo-l-arabinose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pymyphuhkuwmla-vayjurfesa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite CPD-15699
- common-name:
- aldehydo-l-arabinose
- smiles:
- [ch](=o)c(o)c(o)c(o)co
- inchi-key:
- pymyphuhkuwmla-vayjurfesa-n
- molecular-weight:
- 150.131