Difference between revisions of "Odd-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9099 == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(c...")
(Created page with "Category:metabolite == Metabolite Odd-Saturated-Fatty-Acyl-CoA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to c...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9099 ==
+
== Metabolite Odd-Saturated-Fatty-Acyl-CoA ==
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl bacteriopheophytin
+
** an odd numbered straight chain 2,3,4-saturated fatty acyl coa
* smiles:
 
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 
* inchi-key:
 
** fzuvlshmhogmop-xqjlcrkzsa-n
 
* molecular-weight:
 
** 884.189
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8795]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8794]]
+
* [[RXN66-477]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty acyl coa}}
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
 
{{#set: molecular-weight=884.189}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Odd-Saturated-Fatty-Acyl-CoA

  • common-name:
    • an odd numbered straight chain 2,3,4-saturated fatty acyl coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality