Difference between revisions of "Odd-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13393 == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=o)c[n+] * inchi-key: ** pfmuccyyaafkth-yfkpbyrvsa-n *...")
(Created page with "Category:metabolite == Metabolite CPD-9099 == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13393 ==
+
== Metabolite CPD-9099 ==
 
* common-name:
 
* common-name:
** glycyl-l-methionine
+
** dihydrogeranylgeranyl bacteriopheophytin
 
* smiles:
 
* smiles:
** csccc(c(=o)[o-])nc(=o)c[n+]
+
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 
* inchi-key:
 
* inchi-key:
** pfmuccyyaafkth-yfkpbyrvsa-n
+
** fzuvlshmhogmop-xqjlcrkzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 206.259
+
** 884.189
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6974]]
+
* [[RXN-8795]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8794]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycyl-l-methionine}}
+
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
{{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}}
+
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
{{#set: molecular-weight=206.259}}
+
{{#set: molecular-weight=884.189}}

Revision as of 14:55, 5 January 2021

Metabolite CPD-9099

  • common-name:
    • dihydrogeranylgeranyl bacteriopheophytin
  • smiles:
    • ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
  • inchi-key:
    • fzuvlshmhogmop-xqjlcrkzsa-n
  • molecular-weight:
    • 884.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality