Difference between revisions of "Odd-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9099 == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(c...")
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL == * common-name: ** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9099 ==
+
== Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL ==
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl bacteriopheophytin
+
** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** fzuvlshmhogmop-xqjlcrkzsa-n
+
** zagwhopypmukok-fricuitqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 884.189
+
** 548.848
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8795]]
+
* [[RXN3O-54]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8794]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
+
{{#set: inchi-key=inchikey=zagwhopypmukok-fricuitqsa-n}}
{{#set: molecular-weight=884.189}}
+
{{#set: molecular-weight=548.848}}

Revision as of 15:26, 5 January 2021

Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL

  • common-name:
    • 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
  • inchi-key:
    • zagwhopypmukok-fricuitqsa-n
  • molecular-weight:
    • 548.848

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality