Difference between revisions of "Odd-Straight-Chain-234-Sat-FA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOACYL-COA == * common-name: ** a 3-oxoacyl-coa == Reaction(s) known to consume the compound == * KETOACYLCOATHIOL-RXN * RXN-13...")
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-KETOACYL-COA ==
+
== Metabolite CPD-19158 ==
 
* common-name:
 
* common-name:
** a 3-oxoacyl-coa
+
** 3-oxo-(9z)-hexadecenoyl-coa
 +
* smiles:
 +
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** jdnargywmlyada-mdmkaecgsa-j
 +
* molecular-weight:
 +
** 1013.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[KETOACYLCOATHIOL-RXN]]
+
* [[RXN-17791]]
* [[RXN-13279]]
 
* [[RXN-16133]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHACYL-COA-DEHYDROG-RXN]]
+
* [[RXN-17790]]
* [[RXN-13279]]
 
* [[RXN-16133]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxoacyl-coa}}
+
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
 +
{{#set: molecular-weight=1013.883}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-19158

  • common-name:
    • 3-oxo-(9z)-hexadecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jdnargywmlyada-mdmkaecgsa-j
  • molecular-weight:
    • 1013.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality