Difference between revisions of "Odd-Straight-Chain-234-Sat-FALD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10706 == * transcription-direction: ** negative * right-end-position: ** 85128 * left-end-position: ** 79547 * centisome-position: ** 10.093490...")
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10706 ==
+
== Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE ==
* transcription-direction:
+
* common-name:
** negative
+
** 3-hexaprenyl-4-hydroxybenzoate
* right-end-position:
+
* smiles:
** 85128
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
* left-end-position:
+
* inchi-key:
** 79547
+
** lkmqqqabigihgl-laaqxviisa-m
* centisome-position:
+
* molecular-weight:
** 10.093490   
+
** 545.824
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-9003]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=545.824}}
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-10949]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10952]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10953]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10954]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-7253]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN0-5408]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-2301]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-6363]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-4702]]
 
** '''3''' reactions found over '''14''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=85128}}
 
{{#set: left-end-position=79547}}
 
{{#set: centisome-position=10.093490    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=8}}
 
{{#set: nb pathway associated=3}}
 

Revision as of 20:32, 18 December 2020

Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE

  • common-name:
    • 3-hexaprenyl-4-hydroxybenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
  • inchi-key:
    • lkmqqqabigihgl-laaqxviisa-m
  • molecular-weight:
    • 545.824

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality