Difference between revisions of "Oleoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9700 == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) * inchi-key: ** uydzycpiqsrxku-n...")
(Created page with "Category:metabolite == Metabolite Oleoyl-ACPs == * common-name: ** an oleoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16077 * RXN-16629 == React...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9700 ==
+
== Metabolite Oleoyl-ACPs ==
 
* common-name:
 
* common-name:
** hypoglycin b
+
** an oleoyl-[acp]
* smiles:
 
** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
 
* inchi-key:
 
** uydzycpiqsrxku-nppuscpjsa-m
 
* molecular-weight:
 
** 269.277
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16077]]
 +
* [[RXN-16629]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9157]]
+
* [[RXN-16628]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hypoglycin b}}
+
{{#set: common-name=an oleoyl-[acp]}}
{{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}}
 
{{#set: molecular-weight=269.277}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Oleoyl-ACPs

  • common-name:
    • an oleoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an oleoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.