Difference between revisions of "Oleoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-276 RXN0-276] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/1.1.1...") |
(Created page with "Category:metabolite == Metabolite CPD-15279 == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide * smiles: ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15279 == |
| − | * | + | * common-name: |
| − | ** | + | ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide |
| − | * | + | * smiles: |
| − | ** [ | + | ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c |
| − | == | + | * inchi-key: |
| − | + | ** sjhlsluuwibqns-tylceogasa-m | |
| − | = | + | * molecular-weight: |
| − | * | + | ** 460.481 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | ** | + | * [[RXN-14430]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}} |
| − | * | + | {{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}} |
| − | + | {{#set: molecular-weight=460.481}} | |
| − | == | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-15279
- common-name:
- γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
- smiles:
- c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
- inchi-key:
- sjhlsluuwibqns-tylceogasa-m
- molecular-weight:
- 460.481
