Difference between revisions of "Oleoyl-lipid"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05163 == * transcription-direction: ** negative * right-end-position: ** 57053 * left-end-position: ** 38739 * centisome-position: ** 40.220314...") |
(Created page with "Category:metabolite == Metabolite CPD-11527 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cc(o)cc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11527 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa |
| − | * | + | * smiles: |
| − | ** | + | ** ccc=ccc1(c(ccc(=o)1)cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]) |
| − | * | + | * inchi-key: |
| − | ** | + | ** yufhotsrmdfgns-gbypgrtbsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 999.813 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10703]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[RXN- | + | * [[RXN-10705]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa}} | |
| − | == | + | {{#set: inchi-key=inchikey=yufhotsrmdfgns-gbypgrtbsa-j}} |
| − | + | {{#set: molecular-weight=999.813}} | |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-11527
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa
- smiles:
- ccc=ccc1(c(ccc(=o)1)cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
- inchi-key:
- yufhotsrmdfgns-gbypgrtbsa-j
- molecular-weight:
- 999.813
