Difference between revisions of "Oleoyl-lipid"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * smiles: ** c1(c(o)c(co)oc1op(=o)([o-])[o-]) * inch...") |
(Created page with "Category:metabolite == Metabolite N-acetyl-D-glucosamine-asparagine == * common-name: ** n-acetyl-d-glucosamine-asparagine == Reaction(s) known to consume the compound ==...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N-acetyl-D-glucosamine-asparagine == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-d-glucosamine-asparagine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.2.1.96-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-glucosamine-asparagine}} |
− | |||
− |
Revision as of 18:56, 14 January 2021
Contents
Metabolite N-acetyl-D-glucosamine-asparagine
- common-name:
- n-acetyl-d-glucosamine-asparagine