Difference between revisions of "Oligomers-Of-16beta-D-Glucans"

Revision as of 11:20, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 2-ACETO-LACTATE ==
+== Metabolite THIAMINE-PYROPHOSPHATE ==
 * common-name:
-** (s)-2-acetolactate
+** thiamine diphosphate
 * smiles:
-** cc(=o)c(c)(o)c(=o)[o-]
+** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 * inchi-key:
-** nmdwgegfjubklb-yfkpbyrvsa-m
+** ayekofbpnlcajy-uhfffaoysa-l
 * molecular-weight:
-** 131.108
+** 422.288
 == Reaction(s) known to consume the compound ==
-* [[ACETOLACTREDUCTOISOM-RXN]]
+* [[RXN-12583]]
 * [[RXN-14037]]
+* [[RXN0-3542]]
 == Reaction(s) known to produce the compound ==
-* [[ACETOLACTSYN-RXN]]
+* [[PDHam2hi]]
+* [[PDHam2mi]]
+* [[RXN-12508]]
 * [[RXN-14037]]
+* [[RXN0-3542]]
+* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
+* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-2-acetolactate}}
+{{#set: common-name=thiamine diphosphate}}
-{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
+{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
-{{#set: molecular-weight=131.108}}
+{{#set: molecular-weight=422.288}}