Difference between revisions of "Oligomers-Of-16beta-D-Glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...") |
(Created page with "Category:metabolite == Metabolite Oligomers-Of-16beta-D-Glucans == * common-name: ** a (1→6)-β-linked oligosaccharide == Reaction(s) known to consume the compoun...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Oligomers-Of-16beta-D-Glucans == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (1→6)-β-linked oligosaccharide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[3.1. | + | * [[3.2.1.75-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (1→6)-β-linked oligosaccharide}} |
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite Oligomers-Of-16beta-D-Glucans
- common-name:
- a (1→6)-β-linked oligosaccharide
