Difference between revisions of "Oligomers-Of-16beta-D-Glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17348 == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: ** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)...") |
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PANTETHEINE-P == |
* common-name: | * common-name: | ||
− | ** | + | ** 4'-phosphopantetheine |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jdmuprlruumctl-vifpvbqesa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 356.33 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[PANTEPADENYLYLTRAN-RXN]] |
+ | * [[PANTETHEINE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3.1.4.14-RXN]] |
+ | * [[P-PANTOCYSDECARB-RXN]] | ||
+ | * [[PANTETHEINE-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4'-phosphopantetheine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=356.33}} |
Revision as of 15:31, 5 January 2021
Contents
Metabolite PANTETHEINE-P
- common-name:
- 4'-phosphopantetheine
- smiles:
- cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
- inchi-key:
- jdmuprlruumctl-vifpvbqesa-l
- molecular-weight:
- 356.33