Difference between revisions of "Oligomers-Of-16beta-D-Glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...") |
(Created page with "Category:metabolite == Metabolite All-trans-Retinyl-Esters == * common-name: ** an all-trans-retinyl ester == Reaction(s) known to consume the compound == * RETINOL-O-FA...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite All-trans-Retinyl-Esters == |
* common-name: | * common-name: | ||
− | ** | + | ** an all-trans-retinyl ester |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] |
− | * [[ | + | * [[RXN-12575]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an all-trans-retinyl ester}} |
− | |||
− |
Revision as of 13:13, 14 January 2021
Contents
Metabolite All-trans-Retinyl-Esters
- common-name:
- an all-trans-retinyl ester