Difference between revisions of "Oligonucleotides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...") |
(Created page with "Category:metabolite == Metabolite Oligonucleotides == * common-name: ** an oligonucleotide == Reaction(s) known to consume the compound == * 3.1.4.1-RXN == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Oligonucleotides == |
* common-name: | * common-name: | ||
| − | ** | + | ** an oligonucleotide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.4.1-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.4.1-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an oligonucleotide}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Oligonucleotides
- common-name:
- an oligonucleotide
