Difference between revisions of "Oligonucleotides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11712 == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))...")
(Created page with "Category:metabolite == Metabolite Hexanoyl-ACPs == * common-name: ** a hexanoyl-[acyl-carrier-protein] == Reaction(s) known to consume the compound == * RXN-9523 * R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11712 ==
+
== Metabolite Hexanoyl-ACPs ==
 
* common-name:
 
* common-name:
** 2-methyl-6-geranylgeranyl-1,4-benzoquinol
+
** a hexanoyl-[acyl-carrier-protein]
* smiles:
 
** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
 
* inchi-key:
 
** dowccbnjuzolrj-mlagypmbsa-n
 
* molecular-weight:
 
** 396.612
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14917]]
+
* [[RXN-9523]]
 +
* [[RXN-9650]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14929]]
+
* [[RXN-9521]]
 +
* [[RXN-9658]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: common-name=a hexanoyl-[acyl-carrier-protein]}}
{{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}}
 
{{#set: molecular-weight=396.612}}
 

Revision as of 14:58, 5 January 2021

Metabolite Hexanoyl-ACPs

  • common-name:
    • a hexanoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a hexanoyl-[acyl-carrier-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.