Difference between revisions of "Orthophosphoric-Monoesters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19492 == * common-name: ** 3-ethyl-2-oxosuccinate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])=o * inchi-key: ** ouglpihdpbrsid-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite Orthophosphoric-Monoesters == * common-name: ** a phosphate monoester == Reaction(s) known to consume the compound == * ACID-PHOSPHATAS...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19492 ==
+
== Metabolite Orthophosphoric-Monoesters ==
 
* common-name:
 
* common-name:
** 3-ethyl-2-oxosuccinate
+
** a phosphate monoester
* smiles:
 
** ccc(c([o-])=o)c(c(=o)[o-])=o
 
* inchi-key:
 
** ouglpihdpbrsid-uhfffaoysa-l
 
* molecular-weight:
 
** 158.11
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18210]]
+
* [[ACID-PHOSPHATASE-RXN]]
 +
* [[ALKAPHOSPHA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18210]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-ethyl-2-oxosuccinate}}
+
{{#set: common-name=a phosphate monoester}}
{{#set: inchi-key=inchikey=ouglpihdpbrsid-uhfffaoysa-l}}
 
{{#set: molecular-weight=158.11}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Orthophosphoric-Monoesters

  • common-name:
    • a phosphate monoester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality