Difference between revisions of "Ox-NADPH-Hemoprotein-Reductases"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09637 == * transcription-direction: ** negative * right-end-position: ** 282279 * left-end-position: ** 275473 * centisome-position: ** 67.324005...") |
(Created page with "Category:metabolite == Metabolite CPD0-2108 == * common-name: ** (2e)-oct-2-enoyl-coa * smiles: ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-2108 == |
| − | * | + | * common-name: |
| − | ** | + | ** (2e)-oct-2-enoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** cpsdnaxxkwvyiy-ntlmcjqisa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 887.685 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14229]] |
| − | == Reaction(s) | + | * [[RXN-14276]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[ACOA80OR]] |
| − | + | * [[RXN-12669]] | |
| − | * [[RXN- | + | * [[RXN-14229]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(2e)-oct-2-enoyl-coa}} | |
| − | == | + | {{#set: inchi-key=inchikey=cpsdnaxxkwvyiy-ntlmcjqisa-j}} |
| − | + | {{#set: molecular-weight=887.685}} | |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD0-2108
- common-name:
- (2e)-oct-2-enoyl-coa
- smiles:
- cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- cpsdnaxxkwvyiy-ntlmcjqisa-j
- molecular-weight:
- 887.685
