Difference between revisions of "Oxidized-2Fe-2S-Ferredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9865 == * common-name: ** 6-(all-trans-decaprenyl)-2-methoxy-phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite ACETONE == * common-name: ** acetone * smiles: ** cc(=o)c * inchi-key: ** cscppacgzoocgx-uhfffaoysa-n * molecular-weight: ** 58.08 == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9865 ==
+
== Metabolite ACETONE ==
 
* common-name:
 
* common-name:
** 6-(all-trans-decaprenyl)-2-methoxy-phenol
+
** acetone
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
+
** cc(=o)c
 
* inchi-key:
 
* inchi-key:
** fyllwsgfaaqkhu-gbbrockzsa-n
+
** cscppacgzoocgx-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 805.321
+
** 58.08
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8630]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9233]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-(all-trans-decaprenyl)-2-methoxy-phenol}}
+
{{#set: common-name=acetone}}
{{#set: inchi-key=inchikey=fyllwsgfaaqkhu-gbbrockzsa-n}}
+
{{#set: inchi-key=inchikey=cscppacgzoocgx-uhfffaoysa-n}}
{{#set: molecular-weight=805.321}}
+
{{#set: molecular-weight=58.08}}

Revision as of 11:14, 15 January 2021

Metabolite ACETONE

  • common-name:
    • acetone
  • smiles:
    • cc(=o)c
  • inchi-key:
    • cscppacgzoocgx-uhfffaoysa-n
  • molecular-weight:
    • 58.08

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality