Difference between revisions of "Oxidized-2Fe-2S-Ferredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Beta-D-fucosides == * common-name: ** a β-d fucoside == Reaction(s) known to consume the compound == * 3.2.1.38-RXN == Reaction(...")
(Created page with "Category:metabolite == Metabolite CPD-9865 == * common-name: ** 6-(all-trans-decaprenyl)-2-methoxy-phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Beta-D-fucosides ==
+
== Metabolite CPD-9865 ==
 
* common-name:
 
* common-name:
** a β-d fucoside
+
** 6-(all-trans-decaprenyl)-2-methoxy-phenol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** fyllwsgfaaqkhu-gbbrockzsa-n
 +
* molecular-weight:
 +
** 805.321
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.38-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9233]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a β-d fucoside}}
+
{{#set: common-name=6-(all-trans-decaprenyl)-2-methoxy-phenol}}
 +
{{#set: inchi-key=inchikey=fyllwsgfaaqkhu-gbbrockzsa-n}}
 +
{{#set: molecular-weight=805.321}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-9865

  • common-name:
    • 6-(all-trans-decaprenyl)-2-methoxy-phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • fyllwsgfaaqkhu-gbbrockzsa-n
  • molecular-weight:
    • 805.321

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality