Difference between revisions of "Oxidized-NrdH-Proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DAMP == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: ** khwchtkseggwex-rr...") |
(Created page with "Category:metabolite == Metabolite Oxidized-NrdH-Proteins == * common-name: ** an oxidized nrdh glutaredoxin-like protein == Reaction(s) known to consume the compound == ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Oxidized-NrdH-Proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** an oxidized nrdh glutaredoxin-like protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] |
| − | * [[ | + | * [[RXN0-722]] |
| − | * [[ | + | * [[RXN0-747]] |
| − | * [[RXN0- | + | * [[RXN0-748]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an oxidized nrdh glutaredoxin-like protein}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Oxidized-NrdH-Proteins
- common-name:
- an oxidized nrdh glutaredoxin-like protein
