Difference between revisions of "Oxidized-Rubredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15203 == * transcription-direction: ** negative * right-end-position: ** 168210 * left-end-position: ** 162949 * centisome-position: ** 54.217297...")
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ15203 ==
+
== Metabolite CPD-10712 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** di-trans, poly-cis-polyprenyl diphosphate (c80)
−
* right-end-position:
+
* smiles:
−
** 168210
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 162949
+
** tunipipdjadhsr-hiqrjctmsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 54.217297   
+
** 1264.842
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-9969]]
−
* [[IDI]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
−
* [[IPPISOM-RXN]]
+
{{#set: molecular-weight=1264.842}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY-5123]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[NONMEVIPP-PWY]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6383]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6174]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7560]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7524]]
 
−
** '''5''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7391]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-922]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7102]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6859]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=168210}}
 
−
{{#set: left-end-position=162949}}
 
−
{{#set: centisome-position=54.217297    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=10}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-10712

  • common-name:
    • di-trans, poly-cis-polyprenyl diphosphate (c80)
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
  • inchi-key:
    • tunipipdjadhsr-hiqrjctmsa-k
  • molecular-weight:
    • 1264.842

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Oxidized-Rubredoxins&oldid=45683"