Difference between revisions of "Oxidized-Rubredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite CPD-1828 == * common-name: ** gdp-α-d-mannuronate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10712 ==
+
== Metabolite CPD-1828 ==
 
* common-name:
 
* common-name:
** di-trans, poly-cis-polyprenyl diphosphate (c80)
+
** gdp-α-d-mannuronate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
+
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
* inchi-key:
** tunipipdjadhsr-hiqrjctmsa-k
+
** dnbsdudynpjvcn-zxtxfpbhsa-k
 
* molecular-weight:
 
* molecular-weight:
** 1264.842
+
** 616.305
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ALGINATE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9969]]
+
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
+
{{#set: common-name=gdp-α-d-mannuronate}}
{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
+
{{#set: inchi-key=inchikey=dnbsdudynpjvcn-zxtxfpbhsa-k}}
{{#set: molecular-weight=1264.842}}
+
{{#set: molecular-weight=616.305}}

Revision as of 14:53, 5 January 2021

Metabolite CPD-1828

  • common-name:
    • gdp-α-d-mannuronate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))
  • inchi-key:
    • dnbsdudynpjvcn-zxtxfpbhsa-k
  • molecular-weight:
    • 616.305

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality