Difference between revisions of "Oxidized-Rubredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1828 == * common-name: ** gdp-α-d-mannuronate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)...")
(Created page with "Category:metabolite == Metabolite CPD-14152 == * common-name: ** 1,2-benzoquinone monoimine * smiles: ** c1(=cc(=n)c(c=c1)=o) * inchi-key: ** pearlfkwerpxda-uhfffaoysa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1828 ==
+
== Metabolite CPD-14152 ==
 
* common-name:
 
* common-name:
** gdp-α-d-mannuronate
+
** 1,2-benzoquinone monoimine
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))
+
** c1(=cc(=n)c(c=c1)=o)
 
* inchi-key:
 
* inchi-key:
** dnbsdudynpjvcn-zxtxfpbhsa-k
+
** pearlfkwerpxda-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 616.305
+
** 107.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALGINATE-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
* [[RXN-13159]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-mannuronate}}
+
{{#set: common-name=1,2-benzoquinone monoimine}}
{{#set: inchi-key=inchikey=dnbsdudynpjvcn-zxtxfpbhsa-k}}
+
{{#set: inchi-key=inchikey=pearlfkwerpxda-uhfffaoysa-n}}
{{#set: molecular-weight=616.305}}
+
{{#set: molecular-weight=107.112}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-14152

  • common-name:
    • 1,2-benzoquinone monoimine
  • smiles:
    • c1(=cc(=n)c(c=c1)=o)
  • inchi-key:
    • pearlfkwerpxda-uhfffaoysa-n
  • molecular-weight:
    • 107.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality