Difference between revisions of "Oxidized-ferredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite Octanoylated-domains == * common-name: ** a [lipoyl-carrier protein] n6-octanoyl-l-lysine == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9904 ==
+
== Metabolite Octanoylated-domains ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
+
** a [lipoyl-carrier protein] n6-octanoyl-l-lysine
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
 
* inchi-key:
 
** kybjqeicwvewil-tuumqracsa-m
 
* molecular-weight:
 
** 643.968
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-949]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9287]]
+
* [[RXN0-5098]]
 +
* [[RXN0-947]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=a [lipoyl-carrier protein] n6-octanoyl-l-lysine}}
{{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}}
 
{{#set: molecular-weight=643.968}}
 

Revision as of 08:30, 15 March 2021

Metabolite Octanoylated-domains

  • common-name:
    • a [lipoyl-carrier protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [lipoyl-carrier protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.