Difference between revisions of "Oxidized-ferredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite Oxidized-ferredoxins == * common-name: ** an oxidized ferredoxin [iron-sulfur] cluster == Reaction(s) known to consume the compound == *...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9904 ==
+
== Metabolite Oxidized-ferredoxins ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
+
** an oxidized ferredoxin [iron-sulfur] cluster
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
 
* inchi-key:
 
** kybjqeicwvewil-tuumqracsa-m
 
* molecular-weight:
 
** 643.968
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.18.1.2-RXN]]
 +
* [[HYDROG-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[R05818]]
 +
* [[R05819]]
 +
* [[RXN-12878]]
 +
* [[RXN-16993]]
 +
* [[RXN-16994]]
 +
* [[RXN-17897]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9287]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.18.1.2-RXN]]
 +
* [[1.3.7.2-RXN]]
 +
* [[1.3.7.3-RXN]]
 +
* [[1.3.7.4-RXN]]
 +
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[HYDROG-RXN]]
 +
* [[ISPH2-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[R05818]]
 +
* [[R05819]]
 +
* [[RXN-16049]]
 +
* [[RXN-16052]]
 +
* [[RXN-16053]]
 +
* [[RXN-16070]]
 +
* [[RXN-16071]]
 +
* [[RXN-16993]]
 +
* [[RXN-16994]]
 +
* [[RXN-1725]]
 +
* [[RXN-17252]]
 +
* [[RXN-1727]]
 +
* [[RXN-17523]]
 +
* [[RXN-17897]]
 +
* [[RXN-7740]]
 +
* [[RXN-7741]]
 +
* [[RXN-7978]]
 +
* [[RXN-7979]]
 +
* [[RXN-8025]]
 +
* [[RXN-8026]]
 +
* [[RXN-8295]]
 +
* [[RXN-8297]]
 +
* [[RXN-8299]]
 +
* [[RXN-8301]]
 +
* [[RXN-8303]]
 +
* [[RXN-8306]]
 +
* [[RXN-8309]]
 +
* [[RXN-8310]]
 +
* [[RXN-8311]]
 +
* [[RXN-8313]]
 +
* [[RXN-8314]]
 +
* [[RXN-8317]]
 +
* [[RXN-8318]]
 +
* [[RXN-8319]]
 +
* [[RXN-8365]]
 +
* [[RXN-8366]]
 +
* [[RXN-8367]]
 +
* [[RXN-8368]]
 +
* [[RXN-9667]]
 +
* [[RXN0-882]]
 +
* [[RXN0-884]]
 +
* [[RXN1F-152]]
 +
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=an oxidized ferredoxin [iron-sulfur] cluster}}
{{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}}
 
{{#set: molecular-weight=643.968}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Oxidized-ferredoxins

  • common-name:
    • an oxidized ferredoxin [iron-sulfur] cluster

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an oxidized ferredoxin [iron-sulfur] cluster" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.