Difference between revisions of "Oxidized-ferredoxins"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTNH DUTNH] == * direction: ** left-to-right * common-name: ** dutp nucleotidohydrolase == Reactio...") |
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o * inchi-key: ** gubgytab...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CELLOBIOSE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-cellobiose |
| − | + | * smiles: | |
| − | * | + | ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o |
| − | + | * inchi-key: | |
| − | * | + | ** gubgytabksrvrq-qrzgkkjrsa-n |
| − | ** | + | * molecular-weight: |
| − | + | ** 342.299 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-10773]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[3.2.1.91-RXN]] |
| − | + | * [[RXN-12305]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=β-d-cellobiose}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}} |
| − | {{#set: | + | {{#set: molecular-weight=342.299}} |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:36, 18 December 2020
Contents
Metabolite CELLOBIOSE
- common-name:
- β-d-cellobiose
- smiles:
- c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
- inchi-key:
- gubgytabksrvrq-qrzgkkjrsa-n
- molecular-weight:
- 342.299
