Difference between revisions of "Oxidized-ferredoxins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o * inchi-key: ** gubgytab...") |
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9904 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kybjqeicwvewil-tuumqracsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 643.968 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-9287]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=643.968}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-9904
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
- inchi-key:
- kybjqeicwvewil-tuumqracsa-m
- molecular-weight:
- 643.968
