Difference between revisions of "Oxidized-flavodoxins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7280 == * common-name: ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(c=cc=c(c)c=cc12(oc...") |
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD | + | == Metabolite INDOLEYL-CPD == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (indole-3-yl)acetonitrile |
* smiles: | * smiles: | ||
| − | ** | + | ** c(#n)cc1(=cnc2(c=cc=cc1=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dmcpfobljmlsnx-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 156.187 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1404]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(indole-3-yl)acetonitrile}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dmcpfobljmlsnx-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=156.187}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite INDOLEYL-CPD
- common-name:
- (indole-3-yl)acetonitrile
- smiles:
- c(#n)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- dmcpfobljmlsnx-uhfffaoysa-n
- molecular-weight:
- 156.187
