Difference between revisions of "Oxo-glutarate-dehydrogenase-DH-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Lipoyl-Protein-N6-lipoyllysine == * common-name: ** a [lipoyl-carrier protein]-n6-lipoyl-l-lysine == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite GMP == * common-name: ** gmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** rqfcjasxjcidsx-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite Lipoyl-Protein-N6-lipoyllysine ==
+
== Metabolite GMP ==
 
* common-name:
 
* common-name:
−
** a [lipoyl-carrier protein]-n6-lipoyl-l-lysine
+
** gmp
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 +
* inchi-key:
 +
** rqfcjasxjcidsx-uuokfmhzsa-l
 +
* molecular-weight:
 +
** 361.207
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AGPT]]
 +
* [[GMP-REDUCT-RXN]]
 +
* [[GUANPRIBOSYLTRAN-RXN]]
 +
* [[GUANYL-KIN-RXN]]
 +
* [[RXN-7609]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[1.8.1.4-RXN]]
+
* [[3.6.1.17-RXN]]
−
* [[RXN-17127]]
+
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
−
* [[RXN-8655]]
+
* [[GMP-SYN-GLUT-RXN]]
−
* [[RXN0-949]]
+
* [[GMP-SYN-NH3-RXN]]
 +
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
 +
* [[GUANPRIBOSYLTRAN-RXN]]
 +
* [[NTDP]]
 +
* [[RXN-14140]]
 +
* [[RXN-14201]]
 +
* [[RXN-15713]]
 +
* [[RXN-17923]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=a [lipoyl-carrier protein]-n6-lipoyl-l-lysine}}
+
{{#set: common-name=gmp}}
 +
{{#set: inchi-key=inchikey=rqfcjasxjcidsx-uuokfmhzsa-l}}
 +
{{#set: molecular-weight=361.207}}

Revision as of 18:57, 14 January 2021

Metabolite GMP

  • common-name:
    • gmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • rqfcjasxjcidsx-uuokfmhzsa-l
  • molecular-weight:
    • 361.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Oxo-glutarate-dehydrogenase-DH-lipoyl&oldid=99594"