Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * smiles: ** cc(c...")
(Created page with "Category:metabolite == Metabolite GLUTAMYL-GLX-TRNAS == * common-name: ** an l-glutamyl-[trnaglx] == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C4 ==
+
== Metabolite GLUTAMYL-GLX-TRNAS ==
 
* common-name:
 
* common-name:
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
+
** an l-glutamyl-[trnaglx]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c
 
* inchi-key:
 
** sulooaflxmqjsf-ogdyfqgpsa-k
 
* molecular-weight:
 
** 1670.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
+
* [[6.1.1.24-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}}
+
{{#set: common-name=an l-glutamyl-[trnaglx]}}
{{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}}
 
{{#set: molecular-weight=1670.034}}
 

Revision as of 18:58, 14 January 2021

Metabolite GLUTAMYL-GLX-TRNAS

  • common-name:
    • an l-glutamyl-[trnaglx]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-glutamyl-[trnaglx" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.