Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == * common-name: ** 2-(α-hydroxyethyl)thiamine diphosphate * smiles: ** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c...")
(Created page with "Category:metabolite == Metabolite THIOCYSTEINE == * common-name: ** thiocysteine * smiles: ** c(ss)c(c([o-])=o)[n+] * inchi-key: ** xbkonscrebsmcs-reohclbhsa-n * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-ALPHA-HYDROXYETHYL-THPP ==
+
== Metabolite THIOCYSTEINE ==
 
* common-name:
 
* common-name:
** 2-(α-hydroxyethyl)thiamine diphosphate
+
** thiocysteine
 
* smiles:
 
* smiles:
** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
+
** c(ss)c(c([o-])=o)[n+]
 
* inchi-key:
 
* inchi-key:
** rruvjgasjonmdy-uhfffaoysa-l
+
** xbkonscrebsmcs-reohclbhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 466.341
+
** 153.214
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PDHam2hi]]
 
* [[PDHam2mi]]
 
* [[RXN-12508]]
 
* [[RXN-14037]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12583]]
+
* [[CYSTHIOCYS-RXN]]
* [[RXN-14037]]
+
* [[RXN-15128]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}}
+
{{#set: common-name=thiocysteine}}
{{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=xbkonscrebsmcs-reohclbhsa-n}}
{{#set: molecular-weight=466.341}}
+
{{#set: molecular-weight=153.214}}

Revision as of 14:58, 5 January 2021

Metabolite THIOCYSTEINE

  • common-name:
    • thiocysteine
  • smiles:
    • c(ss)c(c([o-])=o)[n+]
  • inchi-key:
    • xbkonscrebsmcs-reohclbhsa-n
  • molecular-weight:
    • 153.214

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality