Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)o...")
(Created page with "Category:metabolite == Metabolite Oxo-glutarate-dehydrogenase-lipoyl == * common-name: ** a [2-oxoglutarate dehydrogenase e2 protein] n6-lipoyl-l-lysine == Reaction(s) kno...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1028 ==
+
== Metabolite Oxo-glutarate-dehydrogenase-lipoyl ==
 
* common-name:
 
* common-name:
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** a [2-oxoglutarate dehydrogenase e2 protein] n6-lipoyl-l-lysine
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
 
* inchi-key:
 
** oinneunvozhbox-kwbdajkesa-k
 
* molecular-weight:
 
** 447.424
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2OXOGLUTDECARB-RXN]]
 +
* [[RXN-7716]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5180]]
+
* [[RXN-14959]]
 +
* [[RXN-7716]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: common-name=a [2-oxoglutarate dehydrogenase e2 protein] n6-lipoyl-l-lysine}}
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
 
{{#set: molecular-weight=447.424}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Oxo-glutarate-dehydrogenase-lipoyl

  • common-name:
    • a [2-oxoglutarate dehydrogenase e2 protein] n6-lipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [2-oxoglutarate dehydrogenase e2 protein] n6-lipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.