|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSCHOL-RXN PHOSCHOL-RXN] == | + | == Metabolite P-AMINO-BENZOATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** n-acylphosphatidylethanolamine-specific phospholipase d | + | ** 4-aminobenzoate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.1.4.4 ec-3.1.4.4] | + | ** c(=o)([o-])c1(c=cc(=cc=1)n) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[PHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CHOLINE]][c] '''+''' 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c]
| + | ** alynczndiqevrv-uhfffaoysa-m |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ08019]] | + | ** 136.13 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[ADCLY-RXN]] |
| − | ** Category: [[orthology]] | + | * [[H2PTEROATESYNTH-RXN]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | == Pathway(s) == | + | * [[ADCLY-RXN]] |
| − | * [[PWY-7039]], phosphatidate metabolism, as a signaling molecule: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7039 PWY-7039] | + | == Reaction(s) of unknown directionality == |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | {{#set: common-name=4-aminobenzoate}} |
| − | * [[PWY-3561]], choline biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3561 PWY-3561] | + | {{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}} |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | {{#set: molecular-weight=136.13}} |
| − | * [[LIPASYN-PWY]], phospholipases: [http://metacyc.org/META/NEW-IMAGE?object=LIPASYN-PWY LIPASYN-PWY]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14446 14446]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01310 R01310]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P20626 P20626]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z4Q0 Q9Z4Q0]
| |
| − | ** [http://www.uniprot.org/uniprot/P93844 P93844]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43007 Q43007]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43270 Q43270]
| |
| − | ** [http://www.uniprot.org/uniprot/P93400 P93400]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9T052 Q9T052]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9T053 Q9T053]
| |
| − | ** [http://www.uniprot.org/uniprot/Q41142 Q41142]
| |
| − | ** [http://www.uniprot.org/uniprot/O04865 O04865]
| |
| − | ** [http://www.uniprot.org/uniprot/P70496 P70496]
| |
| − | ** [http://www.uniprot.org/uniprot/O74136 O74136]
| |
| − | ** [http://www.uniprot.org/uniprot/O08684 O08684]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=n-acylphosphatidylethanolamine-specific phospholipase d}} | |
| − | {{#set: ec-number=ec-3.1.4.4}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
