Difference between revisions of "P-AMINO-BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Apo-EntB == * common-name: ** an apo-[entb isochorismatase/aryl-carrier protein] == Reaction(s) known to consume the compound == * ENTD...") |
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-])c1(c=cc(=cc=1)n) * inchi-key: ** alynczndiqevrv-uhfffaoysa-...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite P-AMINO-BENZOATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-aminobenzoate |
+ | * smiles: | ||
+ | ** c(=o)([o-])c1(c=cc(=cc=1)n) | ||
+ | * inchi-key: | ||
+ | ** alynczndiqevrv-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 136.13 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ADCLY-RXN]] |
+ | * [[H2PTEROATESYNTH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ADCLY-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-aminobenzoate}} |
+ | {{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=136.13}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite P-AMINO-BENZOATE
- common-name:
- 4-aminobenzoate
- smiles:
- c(=o)([o-])c1(c=cc(=cc=1)n)
- inchi-key:
- alynczndiqevrv-uhfffaoysa-m
- molecular-weight:
- 136.13