Difference between revisions of "P-AMINO-BENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3713 == * common-name: ** cytidine 2',3'-cyclic monophosphate * smiles: ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o * in...")
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-])c1(c=cc(=cc=1)n) * inchi-key: ** alynczndiqevrv-uhfffaoysa-...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3713 ==
+
== Metabolite P-AMINO-BENZOATE ==
 
* common-name:
 
* common-name:
** cytidine 2',3'-cyclic monophosphate
+
** 4-aminobenzoate
 
* smiles:
 
* smiles:
** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
+
** c(=o)([o-])c1(c=cc(=cc=1)n)
 
* inchi-key:
 
* inchi-key:
** nmpzcczxcomsdq-xvfcmesisa-m
+
** alynczndiqevrv-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 304.176
+
** 136.13
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12059]]
+
* [[ADCLY-RXN]]
 +
* [[H2PTEROATESYNTH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ADCLY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cytidine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=4-aminobenzoate}}
{{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}}
+
{{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}}
{{#set: molecular-weight=304.176}}
+
{{#set: molecular-weight=136.13}}

Latest revision as of 11:16, 18 March 2021

Metabolite P-AMINO-BENZOATE

  • common-name:
    • 4-aminobenzoate
  • smiles:
    • c(=o)([o-])c1(c=cc(=cc=1)n)
  • inchi-key:
    • alynczndiqevrv-uhfffaoysa-m
  • molecular-weight:
    • 136.13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality