Difference between revisions of "P-AMINO-BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Apo-EntB == * common-name: ** an apo-[entb isochorismatase/aryl-carrier protein] == Reaction(s) known to consume the compound == * ENTD...") |
(Created page with "Category:metabolite == Metabolite CPD-3713 == * common-name: ** cytidine 2',3'-cyclic monophosphate * smiles: ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o * in...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-3713 == |
* common-name: | * common-name: | ||
− | ** | + | ** cytidine 2',3'-cyclic monophosphate |
+ | * smiles: | ||
+ | ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o | ||
+ | * inchi-key: | ||
+ | ** nmpzcczxcomsdq-xvfcmesisa-m | ||
+ | * molecular-weight: | ||
+ | ** 304.176 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12059]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cytidine 2',3'-cyclic monophosphate}} |
+ | {{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}} | ||
+ | {{#set: molecular-weight=304.176}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite CPD-3713
- common-name:
- cytidine 2',3'-cyclic monophosphate
- smiles:
- c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
- inchi-key:
- nmpzcczxcomsdq-xvfcmesisa-m
- molecular-weight:
- 304.176